C24H30N2O2S — CID 60558203
1-[4-(2-methylmorpholin-4-yl)piperidin-1-yl]-2-phenyl-2-phenylsulfanylethanone (PubChem CID 60558203) has the molecular formula C24H30N2O2S and a molecular weight of 410.58 g/mol. Its IUPAC name is 1-[4-(2-methylmorpholin-4-yl)piperidin-1-yl]-2-phenyl-2-phenylsulfanylethanone.
| Compound Name | 1-[4-(2-methylmorpholin-4-yl)piperidin-1-yl]-2-phenyl-2-phenylsulfanylethanone |
|---|---|
| PubChem CID | 60558203 |
| Molecular Formula | C24H30N2O2S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 1-[4-(2-methylmorpholin-4-yl)piperidin-1-yl]-2-phenyl-2-phenylsulfanylethanone |
| SMILES | CC1CN(C2CCN(C(=O)C(Sc3ccccc3)c3ccccc3)CC2)CCO1 |
| InChI | InChI=1S/C24H30N2O2S/c1-19-18-26(16-17-28-19)21-12-14-25(15-13-21)24(27)23(20-8-4-2-5-9-20)29-22-10-6-3-7-11-22/h2-11,19,21,23H,12-18H2,1H3 |
| InChIKey | VMYWYEGVTVUTFN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |