C19H25N3O3 — CID 56795828
4-[2-[4-(2-methylmorpholin-4-yl)piperidin-1-yl]-2-oxoethoxy]benzonitrile (PubChem CID 56795828) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 4-[2-[4-(2-methylmorpholin-4-yl)piperidin-1-yl]-2-oxoethoxy]benzonitrile.
| Compound Name | 4-[2-[4-(2-methylmorpholin-4-yl)piperidin-1-yl]-2-oxoethoxy]benzonitrile |
|---|---|
| PubChem CID | 56795828 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 4-[2-[4-(2-methylmorpholin-4-yl)piperidin-1-yl]-2-oxoethoxy]benzonitrile |
| SMILES | CC1CN(C2CCN(C(=O)COc3ccc(C#N)cc3)CC2)CCO1 |
| InChI | InChI=1S/C19H25N3O3/c1-15-13-22(10-11-24-15)17-6-8-21(9-7-17)19(23)14-25-18-4-2-16(12-20)3-5-18/h2-5,15,17H,6-11,13-14H2,1H3 |
| InChIKey | DZWHLTOECCTPRB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |