C19H33N3O3 — CID 120991554
methyl 3-[4-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)piperazin-1-yl]butanoate (PubChem CID 120991554) has the molecular formula C19H33N3O3 and a molecular weight of 351.49 g/mol. Its IUPAC name is methyl 3-[4-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)piperazin-1-yl]butanoate.
| Compound Name | methyl 3-[4-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)piperazin-1-yl]butanoate |
|---|---|
| PubChem CID | 120991554 |
| Molecular Formula | C19H33N3O3 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.25 |
| IUPAC Name | methyl 3-[4-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)piperazin-1-yl]butanoate |
| SMILES | COC(=O)CC(C)N1CCN(C(=O)C2CC3CCCC(C2)C3N)CC1 |
| InChI | InChI=1S/C19H33N3O3/c1-13(10-17(23)25-2)21-6-8-22(9-7-21)19(24)16-11-14-4-3-5-15(12-16)18(14)20/h13-16,18H,3-12,20H2,1-2H3 |
| InChIKey | CQQBNHZQLJVWLT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |