C17H25N3O3 — CID 120992002
methyl 4-[(9-aminobicyclo[3.3.1]nonane-3-carbonyl)amino]-1-methylpyrrole-2-carboxylate (PubChem CID 120992002) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is methyl 4-[(9-aminobicyclo[3.3.1]nonane-3-carbonyl)amino]-1-methylpyrrole-2-carboxylate.
| Compound Name | methyl 4-[(9-aminobicyclo[3.3.1]nonane-3-carbonyl)amino]-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 120992002 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | methyl 4-[(9-aminobicyclo[3.3.1]nonane-3-carbonyl)amino]-1-methylpyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)C2CC3CCCC(C2)C3N)cn1C |
| InChI | InChI=1S/C17H25N3O3/c1-20-9-13(8-14(20)17(22)23-2)19-16(21)12-6-10-4-3-5-11(7-12)15(10)18/h8-12,15H,3-7,18H2,1-2H3,(H,19,21) |
| InChIKey | YFGDCRVMDINJJG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |