C16H23N3O3 — CID 99848863
methyl 4-[[(2R)-2-cyclobutylpyrrolidine-1-carbonyl]amino]-1-methylpyrrole-2-carboxylate (PubChem CID 99848863) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is methyl 4-[[(2R)-2-cyclobutylpyrrolidine-1-carbonyl]amino]-1-methylpyrrole-2-carboxylate.
| Compound Name | methyl 4-[[(2R)-2-cyclobutylpyrrolidine-1-carbonyl]amino]-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 99848863 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | methyl 4-[[(2R)-2-cyclobutylpyrrolidine-1-carbonyl]amino]-1-methylpyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)N2CCC[C@@H]2C2CCC2)cn1C |
| InChI | InChI=1S/C16H23N3O3/c1-18-10-12(9-14(18)15(20)22-2)17-16(21)19-8-4-7-13(19)11-5-3-6-11/h9-11,13H,3-8H2,1-2H3,(H,17,21)/t13-/m1/s1 |
| InChIKey | SVCVBHGUROBQKX-CYBMUJFWSA-N |
| XLogP | 2.61 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |