C13H21N3O4S2 — CID 120998995
N-methyl-1-[1-[(6-methylsulfonyl-3-pyridinyl)sulfonyl]piperidin-3-yl]methanamine (PubChem CID 120998995) has the molecular formula C13H21N3O4S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is N-methyl-1-[1-[(6-methylsulfonyl-3-pyridinyl)sulfonyl]piperidin-3-yl]methanamine.
| Compound Name | N-methyl-1-[1-[(6-methylsulfonyl-3-pyridinyl)sulfonyl]piperidin-3-yl]methanamine |
|---|---|
| PubChem CID | 120998995 |
| Molecular Formula | C13H21N3O4S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | N-methyl-1-[1-[(6-methylsulfonyl-3-pyridinyl)sulfonyl]piperidin-3-yl]methanamine |
| SMILES | CNCC1CCCN(S(=O)(=O)c2ccc(S(C)(=O)=O)nc2)C1 |
| InChI | InChI=1S/C13H21N3O4S2/c1-14-8-11-4-3-7-16(10-11)22(19,20)12-5-6-13(15-9-12)21(2,17)18/h5-6,9,11,14H,3-4,7-8,10H2,1-2H3 |
| InChIKey | JHMNNFJFMOUYLL-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |