methyl 1-(2,2-dimethoxyethyl)cyclohexane-1-carboxylate

C12H22O4 — CID 121001274

IUPACmethyl 1-(2,2-dimethoxyethyl)cyclohexane-1-carboxylate
SMILESCOC(=O)C1(CC(OC)OC)CCCCC1
InChIInChI=1S/C12H22O4/c1-14-10(15-2)9-12(11(13)16-3)7-5-4-6-8-12/h10H,4-9H2,1-3H3
InChIKeyVIVAPMQZILPSSF-UHFFFAOYSA-N
MW230.30 g/mol
LogP2.12
Rot. Bonds5

About methyl 1-(2,2-dimethoxyethyl)cyclohexane-1-carboxylate

methyl 1-(2,2-dimethoxyethyl)cyclohexane-1-carboxylate (PubChem CID 121001274) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is methyl 1-(2,2-dimethoxyethyl)cyclohexane-1-carboxylate.

Molecular Properties

Compound Namemethyl 1-(2,2-dimethoxyethyl)cyclohexane-1-carboxylate
PubChem CID121001274
Molecular FormulaC12H22O4
Molecular Weight230.30 g/mol
Exact Mass230.15
IUPAC Namemethyl 1-(2,2-dimethoxyethyl)cyclohexane-1-carboxylate
SMILESCOC(=O)C1(CC(OC)OC)CCCCC1
InChIInChI=1S/C12H22O4/c1-14-10(15-2)9-12(11(13)16-3)7-5-4-6-8-12/h10H,4-9H2,1-3H3
InChIKeyVIVAPMQZILPSSF-UHFFFAOYSA-N
XLogP2.12
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.30
LogP ≤ 52.12
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze methyl 1-(2,2-dimethoxyethyl)cyclohexane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-(2,2-dimethoxyethyl)cyclohexane-1-carboxylate?
The IUPAC name of methyl 1-(2,2-dimethoxyethyl)cyclohexane-1-carboxylate (CID 121001274) is methyl 1-(2,2-dimethoxyethyl)cyclohexane-1-carboxylate.
What is the SMILES notation for methyl 1-(2,2-dimethoxyethyl)cyclohexane-1-carboxylate?
The canonical SMILES for methyl 1-(2,2-dimethoxyethyl)cyclohexane-1-carboxylate is COC(=O)C1(CC(OC)OC)CCCCC1.
What is the InChIKey of methyl 1-(2,2-dimethoxyethyl)cyclohexane-1-carboxylate?
The InChIKey is VIVAPMQZILPSSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O4/c1-14-10(15-2)9-12(11(13)16-3)7-5-4-6-8-12/h10H,4-9H2,1-3H3.
What are the key properties of methyl 1-(2,2-dimethoxyethyl)cyclohexane-1-carboxylate?
methyl 1-(2,2-dimethoxyethyl)cyclohexane-1-carboxylate has a molecular weight of 230.30 g/mol, XLogP of 2.12, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(2,2-dimethoxyethyl)cyclohexane-1-carboxylate is sourced from PubChem (CID 121001274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).