C14H28O4 — CID 18716746
5-(dimethoxymethyl)-2-ethyl-2,5-dimethylheptanoic acid (PubChem CID 18716746) has the molecular formula C14H28O4 and a molecular weight of 260.37 g/mol. Its IUPAC name is 5-(dimethoxymethyl)-2-ethyl-2,5-dimethylheptanoic acid.
| Compound Name | 5-(dimethoxymethyl)-2-ethyl-2,5-dimethylheptanoic acid |
|---|---|
| PubChem CID | 18716746 |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 5-(dimethoxymethyl)-2-ethyl-2,5-dimethylheptanoic acid |
| SMILES | CCC(C)(CCC(C)(CC)C(OC)OC)C(=O)O |
| InChI | InChI=1S/C14H28O4/c1-7-13(3,11(15)16)9-10-14(4,8-2)12(17-5)18-6/h12H,7-10H2,1-6H3,(H,15,16) |
| InChIKey | SEYNXLDHKKMNLK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|