C12H26O2S — CID 121001666
(3R,4R)-4-tert-butylsulfinyl-2,4-dimethylhexan-3-ol (PubChem CID 121001666) has the molecular formula C12H26O2S and a molecular weight of 234.40 g/mol. Its IUPAC name is (3R,4R)-4-tert-butylsulfinyl-2,4-dimethylhexan-3-ol.
| Compound Name | (3R,4R)-4-tert-butylsulfinyl-2,4-dimethylhexan-3-ol |
|---|---|
| PubChem CID | 121001666 |
| Molecular Formula | C12H26O2S |
| Molecular Weight | 234.40 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | (3R,4R)-4-tert-butylsulfinyl-2,4-dimethylhexan-3-ol |
| SMILES | CC[C@](C)([C@H](O)C(C)C)S(=O)C(C)(C)C |
| InChI | InChI=1S/C12H26O2S/c1-8-12(7,10(13)9(2)3)15(14)11(4,5)6/h9-10,13H,8H2,1-7H3/t10-,12-,15?/m1/s1 |
| InChIKey | SFSQNMCRRUWOCQ-VCQMFTIRSA-N |
| XLogP | 2.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |