C12H16N4O3 — CID 121001782
ethyl (3E)-3-[(2-aminopyridine-3-carbonyl)hydrazinylidene]butanoate (PubChem CID 121001782) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is ethyl (3E)-3-[(2-aminopyridine-3-carbonyl)hydrazinylidene]butanoate.
| Compound Name | ethyl (3E)-3-[(2-aminopyridine-3-carbonyl)hydrazinylidene]butanoate |
|---|---|
| PubChem CID | 121001782 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | ethyl (3E)-3-[(2-aminopyridine-3-carbonyl)hydrazinylidene]butanoate |
| SMILES | CCOC(=O)C/C(C)=N/NC(=O)c1cccnc1N |
| InChI | InChI=1S/C12H16N4O3/c1-3-19-10(17)7-8(2)15-16-12(18)9-5-4-6-14-11(9)13/h4-6H,3,7H2,1-2H3,(H2,13,14)(H,16,18)/b15-8+ |
| InChIKey | QUWDGYHPERABNF-OVCLIPMQSA-N |
| XLogP | 0.72 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|