C12H8N2OS2 — CID 121003215
(2Z)-2-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)acetonitrile (PubChem CID 121003215) has the molecular formula C12H8N2OS2 and a molecular weight of 260.34 g/mol. Its IUPAC name is (2Z)-2-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)acetonitrile.
| Compound Name | (2Z)-2-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)acetonitrile |
|---|---|
| PubChem CID | 121003215 |
| Molecular Formula | C12H8N2OS2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | (2Z)-2-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)acetonitrile |
| SMILES | N#C/C=C1\SC(=S)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C12H8N2OS2/c13-7-6-10-11(15)14(12(16)17-10)8-9-4-2-1-3-5-9/h1-6H,8H2/b10-6- |
| InChIKey | QKLQLGFEAHLRDP-POHAHGRESA-N |
| XLogP | 2.45 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|