C12H22O3 — CID 121003879
(2S)-2-[(4S,5S,6R)-2,5-dimethyl-6-[(E)-prop-1-enyl]-1,3-dioxan-4-yl]propan-1-ol (PubChem CID 121003879) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is (2S)-2-[(4S,5S,6R)-2,5-dimethyl-6-[(E)-prop-1-enyl]-1,3-dioxan-4-yl]propan-1-ol.
| Compound Name | (2S)-2-[(4S,5S,6R)-2,5-dimethyl-6-[(E)-prop-1-enyl]-1,3-dioxan-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 121003879 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (2S)-2-[(4S,5S,6R)-2,5-dimethyl-6-[(E)-prop-1-enyl]-1,3-dioxan-4-yl]propan-1-ol |
| SMILES | C/C=C/[C@H]1OC(C)O[C@@H]([C@@H](C)CO)[C@H]1C |
| InChI | InChI=1S/C12H22O3/c1-5-6-11-9(3)12(8(2)7-13)15-10(4)14-11/h5-6,8-13H,7H2,1-4H3/b6-5+/t8-,9-,10?,11+,12-/m0/s1 |
| InChIKey | RJMTXYHGWTXLPU-ANRIBDDWSA-N |
| XLogP | 1.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|