C12H26O3 — CID 161017335
butane-2,3-diol;(E)-but-2-ene;2,3-dimethyloxirane (PubChem CID 161017335) has the molecular formula C12H26O3 and a molecular weight of 218.34 g/mol. Its IUPAC name is butane-2,3-diol;(E)-but-2-ene;2,3-dimethyloxirane.
| Compound Name | butane-2,3-diol;(E)-but-2-ene;2,3-dimethyloxirane |
|---|---|
| PubChem CID | 161017335 |
| Molecular Formula | C12H26O3 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.19 |
| IUPAC Name | butane-2,3-diol;(E)-but-2-ene;2,3-dimethyloxirane |
| SMILES | C/C=C/C.CC(O)C(C)O.CC1OC1C |
| InChI | InChI=1S/C4H10O2.C4H8O.C4H8/c1-3(5)4(2)6;1-3-4(2)5-3;1-3-4-2/h3-6H,1-2H3;3-4H,1-2H3;3-4H,1-2H3/b;;4-3+ |
| InChIKey | TXWYPNJUKDSHAV-VJJINTEWSA-N |
| XLogP | 2.12 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|