About (Z)-but-2-ene;2,3-dimethyloxirane;methane
(Z)-but-2-ene;2,3-dimethyloxirane;methane (PubChem CID 169426301) has the molecular formula C10H24O
and a molecular weight of 160.30 g/mol. Its IUPAC name is (Z)-but-2-ene;2,3-dimethyloxirane;methane.
Molecular Properties
| Compound Name | (Z)-but-2-ene;2,3-dimethyloxirane;methane |
| PubChem CID | 169426301 |
| Molecular Formula | C10H24O |
| Molecular Weight | 160.30 g/mol |
| Exact Mass | 160.18 |
| IUPAC Name | (Z)-but-2-ene;2,3-dimethyloxirane;methane |
| SMILES | C.C.C/C=C\C.CC1OC1C |
| InChI | InChI=1S/C4H8O.C4H8.2CH4/c1-3-4(2)5-3;1-3-4-2;;/h3-4H,1-2H3;3-4H,1-2H3;2*1H4/b;4-3-;; |
| InChIKey | IVBNHGIENUGYFT-MECAPONASA-N |
| XLogP | 3.65 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.30 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-ene;2,3-dimethyloxirane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-ene;2,3-dimethyloxirane;methane?
The IUPAC name of (Z)-but-2-ene;2,3-dimethyloxirane;methane (CID 169426301) is (Z)-but-2-ene;2,3-dimethyloxirane;methane.
What is the SMILES notation for (Z)-but-2-ene;2,3-dimethyloxirane;methane?
The canonical SMILES for (Z)-but-2-ene;2,3-dimethyloxirane;methane is C.C.C/C=C\C.CC1OC1C.
What is the InChIKey of (Z)-but-2-ene;2,3-dimethyloxirane;methane?
The InChIKey is IVBNHGIENUGYFT-MECAPONASA-N. The full InChI is InChI=1S/C4H8O.C4H8.2CH4/c1-3-4(2)5-3;1-3-4-2;;/h3-4H,1-2H3;3-4H,1-2H3;2*1H4/b;4-3-;;.
What are the key properties of (Z)-but-2-ene;2,3-dimethyloxirane;methane?
(Z)-but-2-ene;2,3-dimethyloxirane;methane has a molecular weight of 160.30 g/mol, XLogP of 3.65, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-ene;2,3-dimethyloxirane;methane is sourced from PubChem (CID 169426301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).