C11H8Cl2N2OS — CID 121005827
3-(3,5-dichlorophenyl)-2-methylsulfanylpyrimidin-4-one (PubChem CID 121005827) has the molecular formula C11H8Cl2N2OS and a molecular weight of 287.17 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-2-methylsulfanylpyrimidin-4-one.
| Compound Name | 3-(3,5-dichlorophenyl)-2-methylsulfanylpyrimidin-4-one |
|---|---|
| PubChem CID | 121005827 |
| Molecular Formula | C11H8Cl2N2OS |
| Molecular Weight | 287.17 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-2-methylsulfanylpyrimidin-4-one |
| SMILES | CSc1nccc(=O)n1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H8Cl2N2OS/c1-17-11-14-3-2-10(16)15(11)9-5-7(12)4-8(13)6-9/h2-6H,1H3 |
| InChIKey | ZKELFJZSDGMNDU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.17 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |