C12H26O4 — CID 121009247
(2R,3R)-1,1-dimethoxydecane-2,3-diol (PubChem CID 121009247) has the molecular formula C12H26O4 and a molecular weight of 234.34 g/mol. Its IUPAC name is (2R,3R)-1,1-dimethoxydecane-2,3-diol.
| Compound Name | (2R,3R)-1,1-dimethoxydecane-2,3-diol |
|---|---|
| PubChem CID | 121009247 |
| Molecular Formula | C12H26O4 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | (2R,3R)-1,1-dimethoxydecane-2,3-diol |
| SMILES | CCCCCCC[C@@H](O)[C@@H](O)C(OC)OC |
| InChI | InChI=1S/C12H26O4/c1-4-5-6-7-8-9-10(13)11(14)12(15-2)16-3/h10-14H,4-9H2,1-3H3/t10-,11-/m1/s1 |
| InChIKey | GUTGBKZCOHNOKO-GHMZBOCLSA-N |
| XLogP | 1.69 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|