C12H18N4S2 — CID 121009711
1-[3-(carbamothioylamino)phenyl]-1,3-diethylthiourea (PubChem CID 121009711) has the molecular formula C12H18N4S2 and a molecular weight of 282.44 g/mol. Its IUPAC name is 1-[3-(carbamothioylamino)phenyl]-1,3-diethylthiourea.
| Compound Name | 1-[3-(carbamothioylamino)phenyl]-1,3-diethylthiourea |
|---|---|
| PubChem CID | 121009711 |
| Molecular Formula | C12H18N4S2 |
| Molecular Weight | 282.44 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1-[3-(carbamothioylamino)phenyl]-1,3-diethylthiourea |
| SMILES | CCNC(=S)N(CC)c1cccc(NC(N)=S)c1 |
| InChI | InChI=1S/C12H18N4S2/c1-3-14-12(18)16(4-2)10-7-5-6-9(8-10)15-11(13)17/h5-8H,3-4H2,1-2H3,(H,14,18)(H3,13,15,17) |
| InChIKey | YJYDLCSWCVAJAB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|