C12H17NO2 — CID 121009861
N-[3-(4-oxocyclohex-2-en-1-yl)propyl]prop-2-enamide (PubChem CID 121009861) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is N-[3-(4-oxocyclohex-2-en-1-yl)propyl]prop-2-enamide.
| Compound Name | N-[3-(4-oxocyclohex-2-en-1-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 121009861 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N-[3-(4-oxocyclohex-2-en-1-yl)propyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCC1C=CC(=O)CC1 |
| InChI | InChI=1S/C12H17NO2/c1-2-12(15)13-9-3-4-10-5-7-11(14)8-6-10/h2,5,7,10H,1,3-4,6,8-9H2,(H,13,15) |
| InChIKey | KRNSHUYQDNQXFP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|