C15H21F2NO2 — CID 168720284
2,2-difluoro-4-(4-methyl-5-oxocyclohex-3-en-1-yl)-N-propan-2-ylpent-4-enamide (PubChem CID 168720284) has the molecular formula C15H21F2NO2 and a molecular weight of 285.33 g/mol. Its IUPAC name is 2,2-difluoro-4-(4-methyl-5-oxocyclohex-3-en-1-yl)-N-propan-2-ylpent-4-enamide.
| Compound Name | 2,2-difluoro-4-(4-methyl-5-oxocyclohex-3-en-1-yl)-N-propan-2-ylpent-4-enamide |
|---|---|
| PubChem CID | 168720284 |
| Molecular Formula | C15H21F2NO2 |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2,2-difluoro-4-(4-methyl-5-oxocyclohex-3-en-1-yl)-N-propan-2-ylpent-4-enamide |
| SMILES | C=C(CC(F)(F)C(=O)NC(C)C)C1CC=C(C)C(=O)C1 |
| InChI | InChI=1S/C15H21F2NO2/c1-9(2)18-14(20)15(16,17)8-11(4)12-6-5-10(3)13(19)7-12/h5,9,12H,4,6-8H2,1-3H3,(H,18,20) |
| InChIKey | AOMXBYYGBHEWDO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|