About N-cycloheptyl-2,2-difluoro-4-(4-methyl-5-oxocyclohex-3-en-1-yl)pent-4-enamide
N-cycloheptyl-2,2-difluoro-4-(4-methyl-5-oxocyclohex-3-en-1-yl)pent-4-enamide (PubChem CID 168720290) has the molecular formula C19H27F2NO2
and a molecular weight of 339.43 g/mol. Its IUPAC name is N-cycloheptyl-2,2-difluoro-4-(4-methyl-5-oxocyclohex-3-en-1-yl)pent-4-enamide.
Molecular Properties
| Compound Name | N-cycloheptyl-2,2-difluoro-4-(4-methyl-5-oxocyclohex-3-en-1-yl)pent-4-enamide |
| PubChem CID | 168720290 |
| Molecular Formula | C19H27F2NO2 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | N-cycloheptyl-2,2-difluoro-4-(4-methyl-5-oxocyclohex-3-en-1-yl)pent-4-enamide |
| SMILES | C=C(CC(F)(F)C(=O)NC1CCCCCC1)C1CC=C(C)C(=O)C1 |
| InChI | InChI=1S/C19H27F2NO2/c1-13-9-10-15(11-17(13)23)14(2)12-19(20,21)18(24)22-16-7-5-3-4-6-8-16/h9,15-16H,2-8,10-12H2,1H3,(H,22,24) |
| InChIKey | IWONTMYFMUMDIU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-cycloheptyl-2,2-difluoro-4-(4-methyl-5-oxocyclohex-3-en-1-yl)pent-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-2,2-difluoro-4-(4-methyl-5-oxocyclohex-3-en-1-yl)pent-4-enamide?
The IUPAC name of N-cycloheptyl-2,2-difluoro-4-(4-methyl-5-oxocyclohex-3-en-1-yl)pent-4-enamide (CID 168720290) is N-cycloheptyl-2,2-difluoro-4-(4-methyl-5-oxocyclohex-3-en-1-yl)pent-4-enamide.
What is the SMILES notation for N-cycloheptyl-2,2-difluoro-4-(4-methyl-5-oxocyclohex-3-en-1-yl)pent-4-enamide?
The canonical SMILES for N-cycloheptyl-2,2-difluoro-4-(4-methyl-5-oxocyclohex-3-en-1-yl)pent-4-enamide is C=C(CC(F)(F)C(=O)NC1CCCCCC1)C1CC=C(C)C(=O)C1.
What is the InChIKey of N-cycloheptyl-2,2-difluoro-4-(4-methyl-5-oxocyclohex-3-en-1-yl)pent-4-enamide?
The InChIKey is IWONTMYFMUMDIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27F2NO2/c1-13-9-10-15(11-17(13)23)14(2)12-19(20,21)18(24)22-16-7-5-3-4-6-8-16/h9,15-16H,2-8,10-12H2,1H3,(H,22,24).
What are the key properties of N-cycloheptyl-2,2-difluoro-4-(4-methyl-5-oxocyclohex-3-en-1-yl)pent-4-enamide?
N-cycloheptyl-2,2-difluoro-4-(4-methyl-5-oxocyclohex-3-en-1-yl)pent-4-enamide has a molecular weight of 339.43 g/mol, XLogP of 4.33, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-2,2-difluoro-4-(4-methyl-5-oxocyclohex-3-en-1-yl)pent-4-enamide is sourced from PubChem (CID 168720290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).