C18H31NO2 — CID 5318939
(2E,4E)-N-(2-methylpropyl)-8-oxotetradeca-2,4-dienamide (PubChem CID 5318939) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is (2E,4E)-N-(2-methylpropyl)-8-oxotetradeca-2,4-dienamide.
| Compound Name | (2E,4E)-N-(2-methylpropyl)-8-oxotetradeca-2,4-dienamide |
|---|---|
| PubChem CID | 5318939 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | (2E,4E)-N-(2-methylpropyl)-8-oxotetradeca-2,4-dienamide |
| SMILES | CCCCCCC(=O)CC/C=C/C=C/C(=O)NCC(C)C |
| InChI | InChI=1S/C18H31NO2/c1-4-5-6-9-12-17(20)13-10-7-8-11-14-18(21)19-15-16(2)3/h7-8,11,14,16H,4-6,9-10,12-13,15H2,1-3H3,(H,19,21)/b8-7+,14-11+ |
| InChIKey | AMCKSJIHLFXIIZ-DQBULIGTSA-N |
| XLogP | 4.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|