C12H18O4 — CID 121011201
4-ethenyl-2,3,4-triethoxycyclobut-2-en-1-one (PubChem CID 121011201) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 4-ethenyl-2,3,4-triethoxycyclobut-2-en-1-one.
| Compound Name | 4-ethenyl-2,3,4-triethoxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 121011201 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 4-ethenyl-2,3,4-triethoxycyclobut-2-en-1-one |
| SMILES | C=CC1(OCC)C(=O)C(OCC)=C1OCC |
| InChI | InChI=1S/C12H18O4/c1-5-12(16-8-4)10(13)9(14-6-2)11(12)15-7-3/h5H,1,6-8H2,2-4H3 |
| InChIKey | XGYSSHCWUAZKCU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|