C18H22O4 — CID 15004558
2,3,4-trimethoxy-4-undec-10-en-1,5-diynylcyclobut-2-en-1-one (PubChem CID 15004558) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is 2,3,4-trimethoxy-4-undec-10-en-1,5-diynylcyclobut-2-en-1-one.
| Compound Name | 2,3,4-trimethoxy-4-undec-10-en-1,5-diynylcyclobut-2-en-1-one |
|---|---|
| PubChem CID | 15004558 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2,3,4-trimethoxy-4-undec-10-en-1,5-diynylcyclobut-2-en-1-one |
| SMILES | C=CCCCC#CCCC#CC1(OC)C(=O)C(OC)=C1OC |
| InChI | InChI=1S/C18H22O4/c1-5-6-7-8-9-10-11-12-13-14-18(22-4)16(19)15(20-2)17(18)21-3/h5H,1,6-8,11-12H2,2-4H3 |
| InChIKey | AOESMKPYZFOWFH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|