C12H14N2O2 — CID 121011580
3-amino-2-benzyl-4-ethyl-1,2-oxazol-5-one (PubChem CID 121011580) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-amino-2-benzyl-4-ethyl-1,2-oxazol-5-one.
| Compound Name | 3-amino-2-benzyl-4-ethyl-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 121011580 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 3-amino-2-benzyl-4-ethyl-1,2-oxazol-5-one |
| SMILES | CCc1c(N)n(Cc2ccccc2)oc1=O |
| InChI | InChI=1S/C12H14N2O2/c1-2-10-11(13)14(16-12(10)15)8-9-6-4-3-5-7-9/h3-7H,2,8,13H2,1H3 |
| InChIKey | WXIAIPKPLHXDFC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 61.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |