C9H8N2O3 — CID 15307818
2-benzyl-1,2,4-oxadiazolidine-3,5-dione (PubChem CID 15307818) has the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. Its IUPAC name is 2-benzyl-1,2,4-oxadiazolidine-3,5-dione.
| Compound Name | 2-benzyl-1,2,4-oxadiazolidine-3,5-dione |
|---|---|
| PubChem CID | 15307818 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 2-benzyl-1,2,4-oxadiazolidine-3,5-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccccc2)o1 |
| InChI | InChI=1S/C9H8N2O3/c12-8-10-9(13)14-11(8)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,10,12,13) |
| InChIKey | BKNQIORDYCCANN-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |