C18H14N4O7S2 — CID 19038434
2-[[4-[4-[(3,5-dioxo-1,2,4-oxadiazolidin-2-yl)methyl]phenyl]sulfanyloxysulfanylphenyl]methyl]-1,2,4-oxadiazolidine-3,5-dione (PubChem CID 19038434) has the molecular formula C18H14N4O7S2 and a molecular weight of 462.47 g/mol. Its IUPAC name is 2-[[4-[4-[(3,5-dioxo-1,2,4-oxadiazolidin-2-yl)methyl]phenyl]sulfanyloxysulfanylphenyl]methyl]-1,2,4-oxadiazolidine-3,5-dione.
| Compound Name | 2-[[4-[4-[(3,5-dioxo-1,2,4-oxadiazolidin-2-yl)methyl]phenyl]sulfanyloxysulfanylphenyl]methyl]-1,2,4-oxadiazolidine-3,5-dione |
|---|---|
| PubChem CID | 19038434 |
| Molecular Formula | C18H14N4O7S2 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | 2-[[4-[4-[(3,5-dioxo-1,2,4-oxadiazolidin-2-yl)methyl]phenyl]sulfanyloxysulfanylphenyl]methyl]-1,2,4-oxadiazolidine-3,5-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccc(SOSc3ccc(Cn4oc(=O)[nH]c4=O)cc3)cc2)o1 |
| InChI | InChI=1S/C18H14N4O7S2/c23-15-19-17(25)27-21(15)9-11-1-5-13(6-2-11)30-29-31-14-7-3-12(4-8-14)10-22-16(24)20-18(26)28-22/h1-8H,9-10H2,(H,19,23,25)(H,20,24,26) |
| InChIKey | HSHNVNQKNZHHGV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 145.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|