C21H15N3O6 — CID 139680218
2-[[4-[3-(4-nitrophenyl)phenoxy]phenyl]methyl]-1,2,4-oxadiazolidine-3,5-dione (PubChem CID 139680218) has the molecular formula C21H15N3O6 and a molecular weight of 405.37 g/mol. Its IUPAC name is 2-[[4-[3-(4-nitrophenyl)phenoxy]phenyl]methyl]-1,2,4-oxadiazolidine-3,5-dione.
| Compound Name | 2-[[4-[3-(4-nitrophenyl)phenoxy]phenyl]methyl]-1,2,4-oxadiazolidine-3,5-dione |
|---|---|
| PubChem CID | 139680218 |
| Molecular Formula | C21H15N3O6 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 2-[[4-[3-(4-nitrophenyl)phenoxy]phenyl]methyl]-1,2,4-oxadiazolidine-3,5-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccc(Oc3cccc(-c4ccc([N+](=O)[O-])cc4)c3)cc2)o1 |
| InChI | InChI=1S/C21H15N3O6/c25-20-22-21(26)30-23(20)13-14-4-10-18(11-5-14)29-19-3-1-2-16(12-19)15-6-8-17(9-7-15)24(27)28/h1-12H,13H2,(H,22,25,26) |
| InChIKey | IQIBTLPMGVRDJI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|