C12H25NO — CID 121011924
1-cyclononyl-N,N-dimethylmethanamine oxide (PubChem CID 121011924) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is 1-cyclononyl-N,N-dimethylmethanamine oxide.
| Compound Name | 1-cyclononyl-N,N-dimethylmethanamine oxide |
|---|---|
| PubChem CID | 121011924 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 1-cyclononyl-N,N-dimethylmethanamine oxide |
| SMILES | C[N+](C)([O-])CC1CCCCCCCC1 |
| InChI | InChI=1S/C12H25NO/c1-13(2,14)11-12-9-7-5-3-4-6-8-10-12/h12H,3-11H2,1-2H3 |
| InChIKey | SCENMNMDHBDYPS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|