About cyclopentane;cyclopentylmethyl-dimethyl-prop-2-enylazanium;iron
cyclopentane;cyclopentylmethyl-dimethyl-prop-2-enylazanium;iron (PubChem CID 162277252) has the molecular formula C16H32FeN+
and a molecular weight of 294.28 g/mol. Its IUPAC name is cyclopentane;cyclopentylmethyl-dimethyl-prop-2-enylazanium;iron.
Molecular Properties
| Compound Name | cyclopentane;cyclopentylmethyl-dimethyl-prop-2-enylazanium;iron |
| PubChem CID | 162277252 |
| Molecular Formula | C16H32FeN+ |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | cyclopentane;cyclopentylmethyl-dimethyl-prop-2-enylazanium;iron |
| SMILES | C1CCCC1.C=CC[N+](C)(C)CC1CCCC1.[Fe] |
| InChI | InChI=1S/C11H22N.C5H10.Fe/c1-4-9-12(2,3)10-11-7-5-6-8-11;1-2-4-5-3-1;/h4,11H,1,5-10H2,2-3H3;1-5H2;/q+1;; |
| InChIKey | RPFGXLFUGTXNIZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze cyclopentane;cyclopentylmethyl-dimethyl-prop-2-enylazanium;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentane;cyclopentylmethyl-dimethyl-prop-2-enylazanium;iron?
The IUPAC name of cyclopentane;cyclopentylmethyl-dimethyl-prop-2-enylazanium;iron (CID 162277252) is cyclopentane;cyclopentylmethyl-dimethyl-prop-2-enylazanium;iron.
What is the SMILES notation for cyclopentane;cyclopentylmethyl-dimethyl-prop-2-enylazanium;iron?
The canonical SMILES for cyclopentane;cyclopentylmethyl-dimethyl-prop-2-enylazanium;iron is C1CCCC1.C=CC[N+](C)(C)CC1CCCC1.[Fe].
What is the InChIKey of cyclopentane;cyclopentylmethyl-dimethyl-prop-2-enylazanium;iron?
The InChIKey is RPFGXLFUGTXNIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N.C5H10.Fe/c1-4-9-12(2,3)10-11-7-5-6-8-11;1-2-4-5-3-1;/h4,11H,1,5-10H2,2-3H3;1-5H2;/q+1;;.
What are the key properties of cyclopentane;cyclopentylmethyl-dimethyl-prop-2-enylazanium;iron?
cyclopentane;cyclopentylmethyl-dimethyl-prop-2-enylazanium;iron has a molecular weight of 294.28 g/mol, XLogP of 4.39, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentane;cyclopentylmethyl-dimethyl-prop-2-enylazanium;iron is sourced from PubChem (CID 162277252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).