C16H16ClFN4O — CID 121019030
(2-chloro-4-fluorophenyl)-[3-(triazol-2-yl)-8-azabicyclo[3.2.1]octan-8-yl]methanone (PubChem CID 121019030) has the molecular formula C16H16ClFN4O and a molecular weight of 334.78 g/mol. Its IUPAC name is (2-chloro-4-fluorophenyl)-[3-(triazol-2-yl)-8-azabicyclo[3.2.1]octan-8-yl]methanone.
| Compound Name | (2-chloro-4-fluorophenyl)-[3-(triazol-2-yl)-8-azabicyclo[3.2.1]octan-8-yl]methanone |
|---|---|
| PubChem CID | 121019030 |
| Molecular Formula | C16H16ClFN4O |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (2-chloro-4-fluorophenyl)-[3-(triazol-2-yl)-8-azabicyclo[3.2.1]octan-8-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1Cl)N1C2CCC1CC(n1nccn1)C2 |
| InChI | InChI=1S/C16H16ClFN4O/c17-15-7-10(18)1-4-14(15)16(23)21-11-2-3-12(21)9-13(8-11)22-19-5-6-20-22/h1,4-7,11-13H,2-3,8-9H2 |
| InChIKey | ZKUAPOCRWJJFSO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |