C19H25NO3S — CID 121022759
(4-benzylsulfonylpiperidin-1-yl)-cyclohex-3-en-1-ylmethanone (PubChem CID 121022759) has the molecular formula C19H25NO3S and a molecular weight of 347.48 g/mol. Its IUPAC name is (4-benzylsulfonylpiperidin-1-yl)-cyclohex-3-en-1-ylmethanone.
| Compound Name | (4-benzylsulfonylpiperidin-1-yl)-cyclohex-3-en-1-ylmethanone |
|---|---|
| PubChem CID | 121022759 |
| Molecular Formula | C19H25NO3S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (4-benzylsulfonylpiperidin-1-yl)-cyclohex-3-en-1-ylmethanone |
| SMILES | O=C(C1CC=CCC1)N1CCC(S(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H25NO3S/c21-19(17-9-5-2-6-10-17)20-13-11-18(12-14-20)24(22,23)15-16-7-3-1-4-8-16/h1-5,7-8,17-18H,6,9-15H2 |
| InChIKey | DFKCVNHYZGFXOK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|