C16H18ClN3O5 — CID 121026988
3-[(2-chlorophenyl)methyl]-N-(2,2-dimethoxyethyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 121026988) has the molecular formula C16H18ClN3O5 and a molecular weight of 367.79 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-N-(2,2-dimethoxyethyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide.
| Compound Name | 3-[(2-chlorophenyl)methyl]-N-(2,2-dimethoxyethyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 121026988 |
| Molecular Formula | C16H18ClN3O5 |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-N-(2,2-dimethoxyethyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | COC(CNC(=O)c1c[nH]c(=O)n(Cc2ccccc2Cl)c1=O)OC |
| InChI | InChI=1S/C16H18ClN3O5/c1-24-13(25-2)8-18-14(21)11-7-19-16(23)20(15(11)22)9-10-5-3-4-6-12(10)17/h3-7,13H,8-9H2,1-2H3,(H,18,21)(H,19,23) |
| InChIKey | YVJIOHSQWQKYAV-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|