C20H22ClN3O3 — CID 121027251
3-[(2-chlorophenyl)methyl]-N-[2-(cyclohexen-1-yl)ethyl]-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 121027251) has the molecular formula C20H22ClN3O3 and a molecular weight of 387.87 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-N-[2-(cyclohexen-1-yl)ethyl]-2,4-dioxo-1H-pyrimidine-5-carboxamide.
| Compound Name | 3-[(2-chlorophenyl)methyl]-N-[2-(cyclohexen-1-yl)ethyl]-2,4-dioxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 121027251 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-N-[2-(cyclohexen-1-yl)ethyl]-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1c[nH]c(=O)n(Cc2ccccc2Cl)c1=O |
| InChI | InChI=1S/C20H22ClN3O3/c21-17-9-5-4-8-15(17)13-24-19(26)16(12-23-20(24)27)18(25)22-11-10-14-6-2-1-3-7-14/h4-6,8-9,12H,1-3,7,10-11,13H2,(H,22,25)(H,23,27) |
| InChIKey | ZJBLHKITGSEAIG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|