C18H18ClN5O3 — CID 121026993
3-[(2-chlorophenyl)methyl]-N-(3-imidazol-1-ylpropyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 121026993) has the molecular formula C18H18ClN5O3 and a molecular weight of 387.83 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-N-(3-imidazol-1-ylpropyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide.
| Compound Name | 3-[(2-chlorophenyl)methyl]-N-(3-imidazol-1-ylpropyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 121026993 |
| Molecular Formula | C18H18ClN5O3 |
| Molecular Weight | 387.83 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-N-(3-imidazol-1-ylpropyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1c[nH]c(=O)n(Cc2ccccc2Cl)c1=O |
| InChI | InChI=1S/C18H18ClN5O3/c19-15-5-2-1-4-13(15)11-24-17(26)14(10-22-18(24)27)16(25)21-6-3-8-23-9-7-20-12-23/h1-2,4-5,7,9-10,12H,3,6,8,11H2,(H,21,25)(H,22,27) |
| InChIKey | ZUUUXQGPDUHGKR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.83 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|