C20H18ClN3O4 — CID 121027252
3-[(2-chlorophenyl)methyl]-2,4-dioxo-N-(2-phenoxyethyl)-1H-pyrimidine-5-carboxamide (PubChem CID 121027252) has the molecular formula C20H18ClN3O4 and a molecular weight of 399.83 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-2,4-dioxo-N-(2-phenoxyethyl)-1H-pyrimidine-5-carboxamide.
| Compound Name | 3-[(2-chlorophenyl)methyl]-2,4-dioxo-N-(2-phenoxyethyl)-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 121027252 |
| Molecular Formula | C20H18ClN3O4 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-2,4-dioxo-N-(2-phenoxyethyl)-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)c1c[nH]c(=O)n(Cc2ccccc2Cl)c1=O |
| InChI | InChI=1S/C20H18ClN3O4/c21-17-9-5-4-6-14(17)13-24-19(26)16(12-23-20(24)27)18(25)22-10-11-28-15-7-2-1-3-8-15/h1-9,12H,10-11,13H2,(H,22,25)(H,23,27) |
| InChIKey | YHVYVVSZQKGGJX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|