C23H19N3O5 — CID 121033378
8-methoxy-2-oxo-N-[2-(6-oxo-3-phenylpyridazin-1-yl)ethyl]chromene-3-carboxamide (PubChem CID 121033378) has the molecular formula C23H19N3O5 and a molecular weight of 417.42 g/mol. Its IUPAC name is 8-methoxy-2-oxo-N-[2-(6-oxo-3-phenylpyridazin-1-yl)ethyl]chromene-3-carboxamide.
| Compound Name | 8-methoxy-2-oxo-N-[2-(6-oxo-3-phenylpyridazin-1-yl)ethyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 121033378 |
| Molecular Formula | C23H19N3O5 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 8-methoxy-2-oxo-N-[2-(6-oxo-3-phenylpyridazin-1-yl)ethyl]chromene-3-carboxamide |
| SMILES | COc1cccc2cc(C(=O)NCCn3nc(-c4ccccc4)ccc3=O)c(=O)oc12 |
| InChI | InChI=1S/C23H19N3O5/c1-30-19-9-5-8-16-14-17(23(29)31-21(16)19)22(28)24-12-13-26-20(27)11-10-18(25-26)15-6-3-2-4-7-15/h2-11,14H,12-13H2,1H3,(H,24,28) |
| InChIKey | XIPBKICRWHONTD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|