C20H13FN4O5S3 — CID 121044362
4-[(4-fluorophenyl)sulfonylamino]-N-[4-(4-nitrothiophen-2-yl)-1,3-thiazol-2-yl]benzamide (PubChem CID 121044362) has the molecular formula C20H13FN4O5S3 and a molecular weight of 504.55 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)sulfonylamino]-N-[4-(4-nitrothiophen-2-yl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-[(4-fluorophenyl)sulfonylamino]-N-[4-(4-nitrothiophen-2-yl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 121044362 |
| Molecular Formula | C20H13FN4O5S3 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.00 |
| IUPAC Name | 4-[(4-fluorophenyl)sulfonylamino]-N-[4-(4-nitrothiophen-2-yl)-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nc(-c2cc([N+](=O)[O-])cs2)cs1)c1ccc(NS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H13FN4O5S3/c21-13-3-7-16(8-4-13)33(29,30)24-14-5-1-12(2-6-14)19(26)23-20-22-17(11-32-20)18-9-15(10-31-18)25(27)28/h1-11,24H,(H,22,23,26) |
| InChIKey | DTRUPRSVVIKCGZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 131.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|