C16H11N3O5S2 — CID 3621428
N-[4-(4-nitrothiophen-2-yl)-1,3-thiazol-2-yl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 3621428) has the molecular formula C16H11N3O5S2 and a molecular weight of 389.41 g/mol. Its IUPAC name is N-[4-(4-nitrothiophen-2-yl)-1,3-thiazol-2-yl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-[4-(4-nitrothiophen-2-yl)-1,3-thiazol-2-yl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 3621428 |
| Molecular Formula | C16H11N3O5S2 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | N-[4-(4-nitrothiophen-2-yl)-1,3-thiazol-2-yl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | O=C(Nc1nc(-c2cc([N+](=O)[O-])cs2)cs1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H11N3O5S2/c20-15(9-1-2-12-13(5-9)24-4-3-23-12)18-16-17-11(8-26-16)14-6-10(7-25-14)19(21)22/h1-2,5-8H,3-4H2,(H,17,18,20) |
| InChIKey | BWAURHNQCHNAGV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|