C24H19ClN4O2 — CID 121049128
(E)-3-(2-chlorophenyl)-N-[[4-oxo-3-(pyridin-2-ylmethyl)phthalazin-1-yl]methyl]prop-2-enamide (PubChem CID 121049128) has the molecular formula C24H19ClN4O2 and a molecular weight of 430.90 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[[4-oxo-3-(pyridin-2-ylmethyl)phthalazin-1-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[[4-oxo-3-(pyridin-2-ylmethyl)phthalazin-1-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 121049128 |
| Molecular Formula | C24H19ClN4O2 |
| Molecular Weight | 430.90 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[[4-oxo-3-(pyridin-2-ylmethyl)phthalazin-1-yl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)NCc1nn(Cc2ccccn2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C24H19ClN4O2/c25-21-11-4-1-7-17(21)12-13-23(30)27-15-22-19-9-2-3-10-20(19)24(31)29(28-22)16-18-8-5-6-14-26-18/h1-14H,15-16H2,(H,27,30)/b13-12+ |
| InChIKey | USWQWIBTFDGONV-OUKQBFOZSA-N |
| XLogP | 3.82 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.90 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|