C23H18N6O2 — CID 121049138
N-[[4-oxo-3-(pyridin-2-ylmethyl)phthalazin-1-yl]methyl]-3H-benzimidazole-5-carboxamide (PubChem CID 121049138) has the molecular formula C23H18N6O2 and a molecular weight of 410.44 g/mol. Its IUPAC name is N-[[4-oxo-3-(pyridin-2-ylmethyl)phthalazin-1-yl]methyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[[4-oxo-3-(pyridin-2-ylmethyl)phthalazin-1-yl]methyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 121049138 |
| Molecular Formula | C23H18N6O2 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | N-[[4-oxo-3-(pyridin-2-ylmethyl)phthalazin-1-yl]methyl]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(NCc1nn(Cc2ccccn2)c(=O)c2ccccc12)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C23H18N6O2/c30-22(15-8-9-19-20(11-15)27-14-26-19)25-12-21-17-6-1-2-7-18(17)23(31)29(28-21)13-16-5-3-4-10-24-16/h1-11,14H,12-13H2,(H,25,30)(H,26,27) |
| InChIKey | ROVFISSNWCXHDM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |