C26H26N4O4 — CID 121049211
3,4-diethoxy-N-[[4-oxo-3-(pyridin-2-ylmethyl)phthalazin-1-yl]methyl]benzamide (PubChem CID 121049211) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is 3,4-diethoxy-N-[[4-oxo-3-(pyridin-2-ylmethyl)phthalazin-1-yl]methyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[[4-oxo-3-(pyridin-2-ylmethyl)phthalazin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 121049211 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 3,4-diethoxy-N-[[4-oxo-3-(pyridin-2-ylmethyl)phthalazin-1-yl]methyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCc2nn(Cc3ccccn3)c(=O)c3ccccc23)cc1OCC |
| InChI | InChI=1S/C26H26N4O4/c1-3-33-23-13-12-18(15-24(23)34-4-2)25(31)28-16-22-20-10-5-6-11-21(20)26(32)30(29-22)17-19-9-7-8-14-27-19/h5-15H,3-4,16-17H2,1-2H3,(H,28,31) |
| InChIKey | YMZPVKMFWQCYPL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |