C23H24N2O4 — CID 35511449
3-ethoxy-4-(2-phenoxyethoxy)-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 35511449) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-ethoxy-4-(2-phenoxyethoxy)-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | 3-ethoxy-4-(2-phenoxyethoxy)-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 35511449 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 3-ethoxy-4-(2-phenoxyethoxy)-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | CCOc1cc(C(=O)NCc2ccccn2)ccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C23H24N2O4/c1-2-27-22-16-18(23(26)25-17-19-8-6-7-13-24-19)11-12-21(22)29-15-14-28-20-9-4-3-5-10-20/h3-13,16H,2,14-15,17H2,1H3,(H,25,26) |
| InChIKey | LPDKZAQECYOMPF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|