C26H26N4O4 — CID 55795864
3-ethoxy-4-(2-phenoxyethoxy)-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]benzamide (PubChem CID 55795864) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is 3-ethoxy-4-(2-phenoxyethoxy)-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]benzamide.
| Compound Name | 3-ethoxy-4-(2-phenoxyethoxy)-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55795864 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 3-ethoxy-4-(2-phenoxyethoxy)-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]benzamide |
| SMILES | CCOc1cc(C(=O)NCc2ccc(-n3cncn3)cc2)ccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C26H26N4O4/c1-2-32-25-16-21(10-13-24(25)34-15-14-33-23-6-4-3-5-7-23)26(31)28-17-20-8-11-22(12-9-20)30-19-27-18-29-30/h3-13,16,18-19H,2,14-15,17H2,1H3,(H,28,31) |
| InChIKey | BBVZUWMKTFUXTL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|