C23H19ClN4O2 — CID 121049320
2-(2-chlorophenyl)-N-[[4-oxo-3-(pyridin-2-ylmethyl)phthalazin-1-yl]methyl]acetamide (PubChem CID 121049320) has the molecular formula C23H19ClN4O2 and a molecular weight of 418.88 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[[4-oxo-3-(pyridin-2-ylmethyl)phthalazin-1-yl]methyl]acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-[[4-oxo-3-(pyridin-2-ylmethyl)phthalazin-1-yl]methyl]acetamide |
|---|---|
| PubChem CID | 121049320 |
| Molecular Formula | C23H19ClN4O2 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[[4-oxo-3-(pyridin-2-ylmethyl)phthalazin-1-yl]methyl]acetamide |
| SMILES | O=C(Cc1ccccc1Cl)NCc1nn(Cc2ccccn2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C23H19ClN4O2/c24-20-11-4-1-7-16(20)13-22(29)26-14-21-18-9-2-3-10-19(18)23(30)28(27-21)15-17-8-5-6-12-25-17/h1-12H,13-15H2,(H,26,29) |
| InChIKey | YLXZNCUVMIIZME-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |