C21H17ClF3N3O3 — CID 121051645
2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]acetamide (PubChem CID 121051645) has the molecular formula C21H17ClF3N3O3 and a molecular weight of 451.83 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 121051645 |
| Molecular Formula | C21H17ClF3N3O3 |
| Molecular Weight | 451.83 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-6-oxopyridazin-1-yl]-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]acetamide |
| SMILES | O=C(Cn1nc(-c2ccc(Cl)cc2)ccc1=O)NCCOc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H17ClF3N3O3/c22-16-6-4-14(5-7-16)18-8-9-20(30)28(27-18)13-19(29)26-10-11-31-17-3-1-2-15(12-17)21(23,24)25/h1-9,12H,10-11,13H2,(H,26,29) |
| InChIKey | CJZVCFLOOKMXGW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.83 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|