C16H16F3N3O3 — CID 121079751
2-(6-oxopyridazin-1-yl)-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]propanamide (PubChem CID 121079751) has the molecular formula C16H16F3N3O3 and a molecular weight of 355.32 g/mol. Its IUPAC name is 2-(6-oxopyridazin-1-yl)-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]propanamide.
| Compound Name | 2-(6-oxopyridazin-1-yl)-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 121079751 |
| Molecular Formula | C16H16F3N3O3 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-(6-oxopyridazin-1-yl)-N-[2-[3-(trifluoromethyl)phenoxy]ethyl]propanamide |
| SMILES | CC(C(=O)NCCOc1cccc(C(F)(F)F)c1)n1ncccc1=O |
| InChI | InChI=1S/C16H16F3N3O3/c1-11(22-14(23)6-3-7-21-22)15(24)20-8-9-25-13-5-2-4-12(10-13)16(17,18)19/h2-7,10-11H,8-9H2,1H3,(H,20,24) |
| InChIKey | ZHUJRBMFACDQAO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|