C21H34N4O4 — CID 121056458
N'-[[1-[(2,5-dimethylfuran-3-yl)methyl]piperidin-4-yl]methyl]-N-(2-morpholin-4-ylethyl)oxamide (PubChem CID 121056458) has the molecular formula C21H34N4O4 and a molecular weight of 406.53 g/mol. Its IUPAC name is N'-[[1-[(2,5-dimethylfuran-3-yl)methyl]piperidin-4-yl]methyl]-N-(2-morpholin-4-ylethyl)oxamide.
| Compound Name | N'-[[1-[(2,5-dimethylfuran-3-yl)methyl]piperidin-4-yl]methyl]-N-(2-morpholin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 121056458 |
| Molecular Formula | C21H34N4O4 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | N'-[[1-[(2,5-dimethylfuran-3-yl)methyl]piperidin-4-yl]methyl]-N-(2-morpholin-4-ylethyl)oxamide |
| SMILES | Cc1cc(CN2CCC(CNC(=O)C(=O)NCCN3CCOCC3)CC2)c(C)o1 |
| InChI | InChI=1S/C21H34N4O4/c1-16-13-19(17(2)29-16)15-25-6-3-18(4-7-25)14-23-21(27)20(26)22-5-8-24-9-11-28-12-10-24/h13,18H,3-12,14-15H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | HBFSUYNBFXRBFG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|