C20H27ClFN3O3 — CID 160567765
3-(4-chloro-3-fluorophenyl)-N-[[1-(2-morpholin-4-ylethyl)pyrrolidin-3-yl]methyl]-2-oxopropanamide (PubChem CID 160567765) has the molecular formula C20H27ClFN3O3 and a molecular weight of 411.91 g/mol. Its IUPAC name is 3-(4-chloro-3-fluorophenyl)-N-[[1-(2-morpholin-4-ylethyl)pyrrolidin-3-yl]methyl]-2-oxopropanamide.
| Compound Name | 3-(4-chloro-3-fluorophenyl)-N-[[1-(2-morpholin-4-ylethyl)pyrrolidin-3-yl]methyl]-2-oxopropanamide |
|---|---|
| PubChem CID | 160567765 |
| Molecular Formula | C20H27ClFN3O3 |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 3-(4-chloro-3-fluorophenyl)-N-[[1-(2-morpholin-4-ylethyl)pyrrolidin-3-yl]methyl]-2-oxopropanamide |
| SMILES | O=C(Cc1ccc(Cl)c(F)c1)C(=O)NCC1CCN(CCN2CCOCC2)C1 |
| InChI | InChI=1S/C20H27ClFN3O3/c21-17-2-1-15(11-18(17)22)12-19(26)20(27)23-13-16-3-4-25(14-16)6-5-24-7-9-28-10-8-24/h1-2,11,16H,3-10,12-14H2,(H,23,27) |
| InChIKey | OYRNETCCHAXHHU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|