C20H13Cl2N3OS — CID 121080546
1-(3,4-dichlorophenyl)-3-(5-thia-3-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),3,7,11(15),12-hexaen-4-yl)urea (PubChem CID 121080546) has the molecular formula C20H13Cl2N3OS and a molecular weight of 414.32 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(5-thia-3-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),3,7,11(15),12-hexaen-4-yl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(5-thia-3-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),3,7,11(15),12-hexaen-4-yl)urea |
|---|---|
| PubChem CID | 121080546 |
| Molecular Formula | C20H13Cl2N3OS |
| Molecular Weight | 414.32 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(5-thia-3-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),3,7,11(15),12-hexaen-4-yl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nc1nc2c(cc3c4c(cccc42)CC3)s1 |
| InChI | InChI=1S/C20H13Cl2N3OS/c21-14-7-6-12(9-15(14)22)23-19(26)25-20-24-18-13-3-1-2-10-4-5-11(17(10)13)8-16(18)27-20/h1-3,6-9H,4-5H2,(H2,23,24,25,26) |
| InChIKey | WLWZNCGIZZMXGM-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.32 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |