C16H17ClN2O4 — CID 121084227
N-(5-chloro-2-methoxyphenyl)-N'-[1-(furan-2-yl)propan-2-yl]oxamide (PubChem CID 121084227) has the molecular formula C16H17ClN2O4 and a molecular weight of 336.78 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-N'-[1-(furan-2-yl)propan-2-yl]oxamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-N'-[1-(furan-2-yl)propan-2-yl]oxamide |
|---|---|
| PubChem CID | 121084227 |
| Molecular Formula | C16H17ClN2O4 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-N'-[1-(furan-2-yl)propan-2-yl]oxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)C(=O)NC(C)Cc1ccco1 |
| InChI | InChI=1S/C16H17ClN2O4/c1-10(8-12-4-3-7-23-12)18-15(20)16(21)19-13-9-11(17)5-6-14(13)22-2/h3-7,9-10H,8H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | YMUSBOWTFQJHOI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|